About 1-pentan-2-yltetrazole
1-pentan-2-yltetrazole (PubChem CID 54365782) has the molecular formula C6H12N4
and a molecular weight of 140.19 g/mol. Its IUPAC name is 1-pentan-2-yltetrazole.
Molecular Properties
| Compound Name | 1-pentan-2-yltetrazole |
| PubChem CID | 54365782 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 1-pentan-2-yltetrazole |
| SMILES | CCCC(C)n1cnnn1 |
| InChI | InChI=1S/C6H12N4/c1-3-4-6(2)10-5-7-8-9-10/h5-6H,3-4H2,1-2H3 |
| InChIKey | IKVBICPFXSTGEM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pentan-2-yltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentan-2-yltetrazole?
The IUPAC name of 1-pentan-2-yltetrazole (CID 54365782) is 1-pentan-2-yltetrazole.
What is the SMILES notation for 1-pentan-2-yltetrazole?
The canonical SMILES for 1-pentan-2-yltetrazole is CCCC(C)n1cnnn1.
What is the InChIKey of 1-pentan-2-yltetrazole?
The InChIKey is IKVBICPFXSTGEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4/c1-3-4-6(2)10-5-7-8-9-10/h5-6H,3-4H2,1-2H3.
What are the key properties of 1-pentan-2-yltetrazole?
1-pentan-2-yltetrazole has a molecular weight of 140.19 g/mol, XLogP of 1.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentan-2-yltetrazole is sourced from PubChem (CID 54365782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).