About 1-[2-[(4,6-dichloropyrimidin-5-yl)amino]imidazol-1-yl]ethanone
1-[2-[(4,6-dichloropyrimidin-5-yl)amino]imidazol-1-yl]ethanone (PubChem CID 54365975) has the molecular formula C9H7Cl2N5O
and a molecular weight of 272.10 g/mol. Its IUPAC name is 1-[2-[(4,6-dichloropyrimidin-5-yl)amino]imidazol-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[2-[(4,6-dichloropyrimidin-5-yl)amino]imidazol-1-yl]ethanone |
| PubChem CID | 54365975 |
| Molecular Formula | C9H7Cl2N5O |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 1-[2-[(4,6-dichloropyrimidin-5-yl)amino]imidazol-1-yl]ethanone |
| SMILES | CC(=O)n1ccnc1Nc1c(Cl)ncnc1Cl |
| InChI | InChI=1S/C9H7Cl2N5O/c1-5(17)16-3-2-12-9(16)15-6-7(10)13-4-14-8(6)11/h2-4H,1H3,(H,12,15) |
| InChIKey | UPUOIDCCMASUEO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-[(4,6-dichloropyrimidin-5-yl)amino]imidazol-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(4,6-dichloropyrimidin-5-yl)amino]imidazol-1-yl]ethanone?
The IUPAC name of 1-[2-[(4,6-dichloropyrimidin-5-yl)amino]imidazol-1-yl]ethanone (CID 54365975) is 1-[2-[(4,6-dichloropyrimidin-5-yl)amino]imidazol-1-yl]ethanone.
What is the SMILES notation for 1-[2-[(4,6-dichloropyrimidin-5-yl)amino]imidazol-1-yl]ethanone?
The canonical SMILES for 1-[2-[(4,6-dichloropyrimidin-5-yl)amino]imidazol-1-yl]ethanone is CC(=O)n1ccnc1Nc1c(Cl)ncnc1Cl.
What is the InChIKey of 1-[2-[(4,6-dichloropyrimidin-5-yl)amino]imidazol-1-yl]ethanone?
The InChIKey is UPUOIDCCMASUEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Cl2N5O/c1-5(17)16-3-2-12-9(16)15-6-7(10)13-4-14-8(6)11/h2-4H,1H3,(H,12,15).
What are the key properties of 1-[2-[(4,6-dichloropyrimidin-5-yl)amino]imidazol-1-yl]ethanone?
1-[2-[(4,6-dichloropyrimidin-5-yl)amino]imidazol-1-yl]ethanone has a molecular weight of 272.10 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(4,6-dichloropyrimidin-5-yl)amino]imidazol-1-yl]ethanone is sourced from PubChem (CID 54365975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).