About (2,5-dihydroxypyrrol-1-yl) 2-[4-(hydroxymethyl)phenoxy]acetate
(2,5-dihydroxypyrrol-1-yl) 2-[4-(hydroxymethyl)phenoxy]acetate (PubChem CID 54365996) has the molecular formula C13H13NO6
and a molecular weight of 279.25 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[4-(hydroxymethyl)phenoxy]acetate.
Analyze (2,5-dihydroxypyrrol-1-yl) 2-[4-(hydroxymethyl)phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 2-[4-(hydroxymethyl)phenoxy]acetate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 2-[4-(hydroxymethyl)phenoxy]acetate (CID 54365996) is (2,5-dihydroxypyrrol-1-yl) 2-[4-(hydroxymethyl)phenoxy]acetate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 2-[4-(hydroxymethyl)phenoxy]acetate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 2-[4-(hydroxymethyl)phenoxy]acetate is O=C(COc1ccc(CO)cc1)On1c(O)ccc1O.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 2-[4-(hydroxymethyl)phenoxy]acetate?
The InChIKey is UPUVREJGHVMRDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO6/c15-7-9-1-3-10(4-2-9)19-8-13(18)20-14-11(16)5-6-12(14)17/h1-6,15-17H,7-8H2.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 2-[4-(hydroxymethyl)phenoxy]acetate?
(2,5-dihydroxypyrrol-1-yl) 2-[4-(hydroxymethyl)phenoxy]acetate has a molecular weight of 279.25 g/mol, XLogP of 0.43, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 2-[4-(hydroxymethyl)phenoxy]acetate is sourced from PubChem (CID 54365996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).