C16H23N7O5S — CID 54366435
(3S)-3-[[2-[[2-(diaminomethylideneamino)-1,3-thiazole-4-carbonyl]amino]acetyl]amino]-4-oxo-4-piperidin-1-ylbutanoic acid (PubChem CID 54366435) has the molecular formula C16H23N7O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is (3S)-3-[[2-[[2-(diaminomethylideneamino)-1,3-thiazole-4-carbonyl]amino]acetyl]amino]-4-oxo-4-piperidin-1-ylbutanoic acid.
| Compound Name | (3S)-3-[[2-[[2-(diaminomethylideneamino)-1,3-thiazole-4-carbonyl]amino]acetyl]amino]-4-oxo-4-piperidin-1-ylbutanoic acid |
|---|---|
| PubChem CID | 54366435 |
| Molecular Formula | C16H23N7O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | (3S)-3-[[2-[[2-(diaminomethylideneamino)-1,3-thiazole-4-carbonyl]amino]acetyl]amino]-4-oxo-4-piperidin-1-ylbutanoic acid |
| SMILES | NC(N)=Nc1nc(C(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)N2CCCCC2)cs1 |
| InChI | InChI=1S/C16H23N7O5S/c17-15(18)22-16-21-10(8-29-16)13(27)19-7-11(24)20-9(6-12(25)26)14(28)23-4-2-1-3-5-23/h8-9H,1-7H2,(H,19,27)(H,20,24)(H,25,26)(H4,17,18,21,22)/t9-/m0/s1 |
| InChIKey | UQCSWNHONVCMJW-VIFPVBQESA-N |
| XLogP | -1.25 |
| TPSA | 193.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|