About (4-bromo-3,5-dichlorophenyl)methanol
(4-bromo-3,5-dichlorophenyl)methanol (PubChem CID 54366784) has the molecular formula C7H5BrCl2O
and a molecular weight of 255.93 g/mol. Its IUPAC name is (4-bromo-3,5-dichlorophenyl)methanol.
Molecular Properties
| Compound Name | (4-bromo-3,5-dichlorophenyl)methanol |
| PubChem CID | 54366784 |
| Molecular Formula | C7H5BrCl2O |
| Molecular Weight | 255.93 g/mol |
| Exact Mass | 253.89 |
| IUPAC Name | (4-bromo-3,5-dichlorophenyl)methanol |
| SMILES | OCc1cc(Cl)c(Br)c(Cl)c1 |
| InChI | InChI=1S/C7H5BrCl2O/c8-7-5(9)1-4(3-11)2-6(7)10/h1-2,11H,3H2 |
| InChIKey | UQINSWIKRCKCFX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.93 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-3,5-dichlorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-3,5-dichlorophenyl)methanol?
The IUPAC name of (4-bromo-3,5-dichlorophenyl)methanol (CID 54366784) is (4-bromo-3,5-dichlorophenyl)methanol.
What is the SMILES notation for (4-bromo-3,5-dichlorophenyl)methanol?
The canonical SMILES for (4-bromo-3,5-dichlorophenyl)methanol is OCc1cc(Cl)c(Br)c(Cl)c1.
What is the InChIKey of (4-bromo-3,5-dichlorophenyl)methanol?
The InChIKey is UQINSWIKRCKCFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrCl2O/c8-7-5(9)1-4(3-11)2-6(7)10/h1-2,11H,3H2.
What are the key properties of (4-bromo-3,5-dichlorophenyl)methanol?
(4-bromo-3,5-dichlorophenyl)methanol has a molecular weight of 255.93 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-3,5-dichlorophenyl)methanol is sourced from PubChem (CID 54366784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).