About N'-(2-aminoethyl)-N'-[2-(cyclohexadec-8-en-1-ylamino)ethyl]ethane-1,2-diamine
N'-(2-aminoethyl)-N'-[2-(cyclohexadec-8-en-1-ylamino)ethyl]ethane-1,2-diamine (PubChem CID 54366985) has the molecular formula C22H46N4
and a molecular weight of 366.64 g/mol. Its IUPAC name is N'-(2-aminoethyl)-N'-[2-(cyclohexadec-8-en-1-ylamino)ethyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2-aminoethyl)-N'-[2-(cyclohexadec-8-en-1-ylamino)ethyl]ethane-1,2-diamine |
| PubChem CID | 54366985 |
| Molecular Formula | C22H46N4 |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 366.37 |
| IUPAC Name | N'-(2-aminoethyl)-N'-[2-(cyclohexadec-8-en-1-ylamino)ethyl]ethane-1,2-diamine |
| SMILES | NCCN(CCN)CCNC1CCCCCCC=CCCCCCCC1 |
| InChI | InChI=1S/C22H46N4/c23-16-19-26(20-17-24)21-18-25-22-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-22/h1-2,22,25H,3-21,23-24H2 |
| InChIKey | UQMBMZPZJDOOIB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-aminoethyl)-N'-[2-(cyclohexadec-8-en-1-ylamino)ethyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-aminoethyl)-N'-[2-(cyclohexadec-8-en-1-ylamino)ethyl]ethane-1,2-diamine?
The IUPAC name of N'-(2-aminoethyl)-N'-[2-(cyclohexadec-8-en-1-ylamino)ethyl]ethane-1,2-diamine (CID 54366985) is N'-(2-aminoethyl)-N'-[2-(cyclohexadec-8-en-1-ylamino)ethyl]ethane-1,2-diamine.
What is the SMILES notation for N'-(2-aminoethyl)-N'-[2-(cyclohexadec-8-en-1-ylamino)ethyl]ethane-1,2-diamine?
The canonical SMILES for N'-(2-aminoethyl)-N'-[2-(cyclohexadec-8-en-1-ylamino)ethyl]ethane-1,2-diamine is NCCN(CCN)CCNC1CCCCCCC=CCCCCCCC1.
What is the InChIKey of N'-(2-aminoethyl)-N'-[2-(cyclohexadec-8-en-1-ylamino)ethyl]ethane-1,2-diamine?
The InChIKey is UQMBMZPZJDOOIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46N4/c23-16-19-26(20-17-24)21-18-25-22-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-22/h1-2,22,25H,3-21,23-24H2.
What are the key properties of N'-(2-aminoethyl)-N'-[2-(cyclohexadec-8-en-1-ylamino)ethyl]ethane-1,2-diamine?
N'-(2-aminoethyl)-N'-[2-(cyclohexadec-8-en-1-ylamino)ethyl]ethane-1,2-diamine has a molecular weight of 366.64 g/mol, XLogP of 3.81, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-aminoethyl)-N'-[2-(cyclohexadec-8-en-1-ylamino)ethyl]ethane-1,2-diamine is sourced from PubChem (CID 54366985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).