About methyl 14-oxotetradecanoate
methyl 14-oxotetradecanoate (PubChem CID 54367256) has the molecular formula C15H28O3
and a molecular weight of 256.39 g/mol. Its IUPAC name is methyl 14-oxotetradecanoate.
Molecular Properties
| Compound Name | methyl 14-oxotetradecanoate |
| PubChem CID | 54367256 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | methyl 14-oxotetradecanoate |
| SMILES | COC(=O)CCCCCCCCCCCCC=O |
| InChI | InChI=1S/C15H28O3/c1-18-15(17)13-11-9-7-5-3-2-4-6-8-10-12-14-16/h14H,2-13H2,1H3 |
| InChIKey | SDRQPLWGWWJJBZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 14-oxotetradecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 14-oxotetradecanoate?
The IUPAC name of methyl 14-oxotetradecanoate (CID 54367256) is methyl 14-oxotetradecanoate.
What is the SMILES notation for methyl 14-oxotetradecanoate?
The canonical SMILES for methyl 14-oxotetradecanoate is COC(=O)CCCCCCCCCCCCC=O.
What is the InChIKey of methyl 14-oxotetradecanoate?
The InChIKey is SDRQPLWGWWJJBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3/c1-18-15(17)13-11-9-7-5-3-2-4-6-8-10-12-14-16/h14H,2-13H2,1H3.
What are the key properties of methyl 14-oxotetradecanoate?
methyl 14-oxotetradecanoate has a molecular weight of 256.39 g/mol, XLogP of 4.04, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 14-oxotetradecanoate is sourced from PubChem (CID 54367256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).