C11H11F3O4 — CID 54367476
1,4-dimethyl-2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid (PubChem CID 54367476) has the molecular formula C11H11F3O4 and a molecular weight of 264.20 g/mol. Its IUPAC name is 1,4-dimethyl-2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid.
| Compound Name | 1,4-dimethyl-2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 54367476 |
| Molecular Formula | C11H11F3O4 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 1,4-dimethyl-2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CC(C)(C(=O)O)C(C(F)(F)F)=C1 |
| InChI | InChI=1S/C11H11F3O4/c1-9(7(15)16)3-4-10(2,8(17)18)6(5-9)11(12,13)14/h3-5H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | UQTQYVVPLFXEFW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|