C17H18Br2N2O2 — CID 54368020
trans-(2-cyano-1-prop-2-ynylpyrrol-3-yl)methyl (1R,3S)-3-(2,2-dibromoethyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 54368020) has the molecular formula C17H18Br2N2O2 and a molecular weight of 442.15 g/mol. Its IUPAC name is trans-(2-cyano-1-prop-2-ynylpyrrol-3-yl)methyl (1R,3S)-3-(2,2-dibromoethyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-(2-cyano-1-prop-2-ynylpyrrol-3-yl)methyl (1R,3S)-3-(2,2-dibromoethyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54368020 |
| Molecular Formula | C17H18Br2N2O2 |
| Molecular Weight | 442.15 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | trans-(2-cyano-1-prop-2-ynylpyrrol-3-yl)methyl (1R,3S)-3-(2,2-dibromoethyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | C#CCn1ccc(COC(=O)[C@@H]2[C@H](CC(Br)Br)C2(C)C)c1C#N |
| InChI | InChI=1S/C17H18Br2N2O2/c1-4-6-21-7-5-11(13(21)9-20)10-23-16(22)15-12(8-14(18)19)17(15,2)3/h1,5,7,12,14-15H,6,8,10H2,2-3H3/t12-,15-/m0/s1 |
| InChIKey | URDORNFLXSHJLO-WFASDCNBSA-N |
| XLogP | 3.81 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.15 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|