C8H3F13O4 — CID 54368253
2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethoxy)propan-2-yl]oxypropanoic acid (PubChem CID 54368253) has the molecular formula C8H3F13O4 and a molecular weight of 410.08 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethoxy)propan-2-yl]oxypropanoic acid.
| Compound Name | 2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethoxy)propan-2-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 54368253 |
| Molecular Formula | C8H3F13O4 |
| Molecular Weight | 410.08 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | 2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethoxy)propan-2-yl]oxypropanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)C(F)F |
| InChI | InChI=1S/C8H3F13O4/c9-1(10)2(11)24-8(20,21)5(14,6(15,16)17)25-7(18,19)4(12,13)3(22)23/h1-2H,(H,22,23) |
| InChIKey | URHNDVDLDOJQSN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.08 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|