About S-(2,3-dihydroxypropyl) octanethioate
S-(2,3-dihydroxypropyl) octanethioate (PubChem CID 54368311) has the molecular formula C11H22O3S
and a molecular weight of 234.36 g/mol. Its IUPAC name is S-(2,3-dihydroxypropyl) octanethioate.
Molecular Properties
| Compound Name | S-(2,3-dihydroxypropyl) octanethioate |
| PubChem CID | 54368311 |
| Molecular Formula | C11H22O3S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | S-(2,3-dihydroxypropyl) octanethioate |
| SMILES | CCCCCCCC(=O)SCC(O)CO |
| InChI | InChI=1S/C11H22O3S/c1-2-3-4-5-6-7-11(14)15-9-10(13)8-12/h10,12-13H,2-9H2,1H3 |
| InChIKey | URIMHZCQDWDWHV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2,3-dihydroxypropyl) octanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2,3-dihydroxypropyl) octanethioate?
The IUPAC name of S-(2,3-dihydroxypropyl) octanethioate (CID 54368311) is S-(2,3-dihydroxypropyl) octanethioate.
What is the SMILES notation for S-(2,3-dihydroxypropyl) octanethioate?
The canonical SMILES for S-(2,3-dihydroxypropyl) octanethioate is CCCCCCCC(=O)SCC(O)CO.
What is the InChIKey of S-(2,3-dihydroxypropyl) octanethioate?
The InChIKey is URIMHZCQDWDWHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3S/c1-2-3-4-5-6-7-11(14)15-9-10(13)8-12/h10,12-13H,2-9H2,1H3.
What are the key properties of S-(2,3-dihydroxypropyl) octanethioate?
S-(2,3-dihydroxypropyl) octanethioate has a molecular weight of 234.36 g/mol, XLogP of 1.96, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2,3-dihydroxypropyl) octanethioate is sourced from PubChem (CID 54368311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).