C19H21N3O2 — CID 54368561
N-[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]furan-3-carboxamide (PubChem CID 54368561) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]furan-3-carboxamide.
| Compound Name | N-[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 54368561 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]furan-3-carboxamide |
| SMILES | CN(C)C1CCc2[nH]c3ccc(NC(=O)c4ccoc4)cc3c2C1 |
| InChI | InChI=1S/C19H21N3O2/c1-22(2)14-4-6-18-16(10-14)15-9-13(3-5-17(15)21-18)20-19(23)12-7-8-24-11-12/h3,5,7-9,11,14,21H,4,6,10H2,1-2H3,(H,20,23) |
| InChIKey | URNIYMBRCAVSTC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|