C22H19NO5 — CID 54368599
2,3,8,9-tetrahydroxy-5-(3-phenylpropyl)phenanthridin-6-one (PubChem CID 54368599) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2,3,8,9-tetrahydroxy-5-(3-phenylpropyl)phenanthridin-6-one.
| Compound Name | 2,3,8,9-tetrahydroxy-5-(3-phenylpropyl)phenanthridin-6-one |
|---|---|
| PubChem CID | 54368599 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2,3,8,9-tetrahydroxy-5-(3-phenylpropyl)phenanthridin-6-one |
| SMILES | O=c1c2cc(O)c(O)cc2c2cc(O)c(O)cc2n1CCCc1ccccc1 |
| InChI | InChI=1S/C22H19NO5/c24-18-9-14-15-10-19(25)21(27)12-17(15)23(22(28)16(14)11-20(18)26)8-4-7-13-5-2-1-3-6-13/h1-3,5-6,9-12,24-27H,4,7-8H2 |
| InChIKey | UROBAEMEALSTSV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|