C18H19NO5 — CID 54368898
(2S,3R)-3-hydroxy-2-[(2-phenylmethoxybenzoyl)amino]butanoic acid (PubChem CID 54368898) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-[(2-phenylmethoxybenzoyl)amino]butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-[(2-phenylmethoxybenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 54368898 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-[(2-phenylmethoxybenzoyl)amino]butanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccccc1OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H19NO5/c1-12(20)16(18(22)23)19-17(21)14-9-5-6-10-15(14)24-11-13-7-3-2-4-8-13/h2-10,12,16,20H,11H2,1H3,(H,19,21)(H,22,23)/t12-,16+/m1/s1 |
| InChIKey | URTDGHWNBYTOOS-WBMJQRKESA-N |
| XLogP | 1.83 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |