About N-ethyl-2-(1H-1,2,4-triazol-5-ylmethoxy)acetamide
N-ethyl-2-(1H-1,2,4-triazol-5-ylmethoxy)acetamide (PubChem CID 54369226) has the molecular formula C7H12N4O2
and a molecular weight of 184.20 g/mol. Its IUPAC name is N-ethyl-2-(1H-1,2,4-triazol-5-ylmethoxy)acetamide.
Molecular Properties
| Compound Name | N-ethyl-2-(1H-1,2,4-triazol-5-ylmethoxy)acetamide |
| PubChem CID | 54369226 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | N-ethyl-2-(1H-1,2,4-triazol-5-ylmethoxy)acetamide |
| SMILES | CCNC(=O)COCc1ncn[nH]1 |
| InChI | InChI=1S/C7H12N4O2/c1-2-8-7(12)4-13-3-6-9-5-10-11-6/h5H,2-4H2,1H3,(H,8,12)(H,9,10,11) |
| InChIKey | RDKNAPGDXKCPOA-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-2-(1H-1,2,4-triazol-5-ylmethoxy)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-(1H-1,2,4-triazol-5-ylmethoxy)acetamide?
The IUPAC name of N-ethyl-2-(1H-1,2,4-triazol-5-ylmethoxy)acetamide (CID 54369226) is N-ethyl-2-(1H-1,2,4-triazol-5-ylmethoxy)acetamide.
What is the SMILES notation for N-ethyl-2-(1H-1,2,4-triazol-5-ylmethoxy)acetamide?
The canonical SMILES for N-ethyl-2-(1H-1,2,4-triazol-5-ylmethoxy)acetamide is CCNC(=O)COCc1ncn[nH]1.
What is the InChIKey of N-ethyl-2-(1H-1,2,4-triazol-5-ylmethoxy)acetamide?
The InChIKey is RDKNAPGDXKCPOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O2/c1-2-8-7(12)4-13-3-6-9-5-10-11-6/h5H,2-4H2,1H3,(H,8,12)(H,9,10,11).
What are the key properties of N-ethyl-2-(1H-1,2,4-triazol-5-ylmethoxy)acetamide?
N-ethyl-2-(1H-1,2,4-triazol-5-ylmethoxy)acetamide has a molecular weight of 184.20 g/mol, XLogP of -0.54, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-(1H-1,2,4-triazol-5-ylmethoxy)acetamide is sourced from PubChem (CID 54369226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).