C26H33NO4 — CID 54370049
3-[(1-hydroxy-3,3-dimethylpent-4-en-2-yl)carbamoyl]-6-(4-phenylphenyl)hexanoic acid (PubChem CID 54370049) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is 3-[(1-hydroxy-3,3-dimethylpent-4-en-2-yl)carbamoyl]-6-(4-phenylphenyl)hexanoic acid.
| Compound Name | 3-[(1-hydroxy-3,3-dimethylpent-4-en-2-yl)carbamoyl]-6-(4-phenylphenyl)hexanoic acid |
|---|---|
| PubChem CID | 54370049 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 3-[(1-hydroxy-3,3-dimethylpent-4-en-2-yl)carbamoyl]-6-(4-phenylphenyl)hexanoic acid |
| SMILES | C=CC(C)(C)C(CO)NC(=O)C(CCCc1ccc(-c2ccccc2)cc1)CC(=O)O |
| InChI | InChI=1S/C26H33NO4/c1-4-26(2,3)23(18-28)27-25(31)22(17-24(29)30)12-8-9-19-13-15-21(16-14-19)20-10-6-5-7-11-20/h4-7,10-11,13-16,22-23,28H,1,8-9,12,17-18H2,2-3H3,(H,27,31)(H,29,30) |
| InChIKey | USNSRBLCMTZOAN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|