C17H27F9Si — CID 54370098
dimethyl-(1,1,2,2,3,3,4,4,5-nonafluorohexyl)-non-8-enylsilane (PubChem CID 54370098) has the molecular formula C17H27F9Si and a molecular weight of 430.47 g/mol. Its IUPAC name is dimethyl-(1,1,2,2,3,3,4,4,5-nonafluorohexyl)-non-8-enylsilane.
| Compound Name | dimethyl-(1,1,2,2,3,3,4,4,5-nonafluorohexyl)-non-8-enylsilane |
|---|---|
| PubChem CID | 54370098 |
| Molecular Formula | C17H27F9Si |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | dimethyl-(1,1,2,2,3,3,4,4,5-nonafluorohexyl)-non-8-enylsilane |
| SMILES | C=CCCCCCCC[Si](C)(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)F |
| InChI | InChI=1S/C17H27F9Si/c1-5-6-7-8-9-10-11-12-27(3,4)17(25,26)16(23,24)15(21,22)14(19,20)13(2)18/h5,13H,1,6-12H2,2-4H3 |
| InChIKey | USONXEFCTJEZKX-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|