C26H34N4O6 — CID 54370112
1-O-[2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl] 5-O-methyl 2,2,4,4-tetramethylpentanedioate (PubChem CID 54370112) has the molecular formula C26H34N4O6 and a molecular weight of 498.58 g/mol. Its IUPAC name is 1-O-[2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl] 5-O-methyl 2,2,4,4-tetramethylpentanedioate.
| Compound Name | 1-O-[2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl] 5-O-methyl 2,2,4,4-tetramethylpentanedioate |
|---|---|
| PubChem CID | 54370112 |
| Molecular Formula | C26H34N4O6 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 1-O-[2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl] 5-O-methyl 2,2,4,4-tetramethylpentanedioate |
| SMILES | CCN(CCOC(=O)C(C)(C)CC(C)(C)C(=O)OC)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H34N4O6/c1-7-29(16-17-36-24(32)26(4,5)18-25(2,3)23(31)35-6)21-12-8-19(9-13-21)27-28-20-10-14-22(15-11-20)30(33)34/h8-15H,7,16-18H2,1-6H3/b28-27+ |
| InChIKey | USOUICHABWKPQD-BYYHNAKLSA-N |
| XLogP | 6.00 |
| TPSA | 123.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|