About 1-but-3-en-2-yloxybutane
1-but-3-en-2-yloxybutane (PubChem CID 543705) has the molecular formula C8H16O
and a molecular weight of 128.21 g/mol. Its IUPAC name is 1-but-3-en-2-yloxybutane.
Molecular Properties
| Compound Name | 1-but-3-en-2-yloxybutane |
| PubChem CID | 543705 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | 1-but-3-en-2-yloxybutane |
| SMILES | C=CC(C)OCCCC |
| InChI | InChI=1S/C8H16O/c1-4-6-7-9-8(3)5-2/h5,8H,2,4,6-7H2,1,3H3 |
| InChIKey | CQJQTXVQMQMNBT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-but-3-en-2-yloxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-3-en-2-yloxybutane?
The IUPAC name of 1-but-3-en-2-yloxybutane (CID 543705) is 1-but-3-en-2-yloxybutane.
What is the SMILES notation for 1-but-3-en-2-yloxybutane?
The canonical SMILES for 1-but-3-en-2-yloxybutane is C=CC(C)OCCCC.
What is the InChIKey of 1-but-3-en-2-yloxybutane?
The InChIKey is CQJQTXVQMQMNBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O/c1-4-6-7-9-8(3)5-2/h5,8H,2,4,6-7H2,1,3H3.
What are the key properties of 1-but-3-en-2-yloxybutane?
1-but-3-en-2-yloxybutane has a molecular weight of 128.21 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-3-en-2-yloxybutane is sourced from PubChem (CID 543705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).