C28H37NO — CID 54370589
1-tert-butyl-4-[5-[(2-methylpropan-2-yl)oxy]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]piperidine (PubChem CID 54370589) has the molecular formula C28H37NO and a molecular weight of 403.61 g/mol. Its IUPAC name is 1-tert-butyl-4-[5-[(2-methylpropan-2-yl)oxy]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]piperidine.
| Compound Name | 1-tert-butyl-4-[5-[(2-methylpropan-2-yl)oxy]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]piperidine |
|---|---|
| PubChem CID | 54370589 |
| Molecular Formula | C28H37NO |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | 1-tert-butyl-4-[5-[(2-methylpropan-2-yl)oxy]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]piperidine |
| SMILES | CC(C)(C)Oc1ccc2c(c1)C(C1CCN(C(C)(C)C)CC1)c1ccccc1C=C2 |
| InChI | InChI=1S/C28H37NO/c1-27(2,3)29-17-15-22(16-18-29)26-24-10-8-7-9-20(24)11-12-21-13-14-23(19-25(21)26)30-28(4,5)6/h7-14,19,22,26H,15-18H2,1-6H3 |
| InChIKey | USXKKKQRSRMYSV-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|