C17H14O5 — CID 54370637
2-[(2,3-dihydroxyphenyl)methylidene]-6,7-dihydroxy-3,4-dihydronaphthalen-1-one (PubChem CID 54370637) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is 2-[(2,3-dihydroxyphenyl)methylidene]-6,7-dihydroxy-3,4-dihydronaphthalen-1-one.
| Compound Name | 2-[(2,3-dihydroxyphenyl)methylidene]-6,7-dihydroxy-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 54370637 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-[(2,3-dihydroxyphenyl)methylidene]-6,7-dihydroxy-3,4-dihydronaphthalen-1-one |
| SMILES | O=C1C(=Cc2cccc(O)c2O)CCc2cc(O)c(O)cc21 |
| InChI | InChI=1S/C17H14O5/c18-13-3-1-2-10(17(13)22)6-11-5-4-9-7-14(19)15(20)8-12(9)16(11)21/h1-3,6-8,18-20,22H,4-5H2 |
| InChIKey | USYHXZAZEJEBJB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|