C16H27N3O — CID 54370664
6-methoxy-3-N,3-N-dipropyl-1,2,3,4-tetrahydroquinoline-3,8-diamine (PubChem CID 54370664) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 6-methoxy-3-N,3-N-dipropyl-1,2,3,4-tetrahydroquinoline-3,8-diamine.
| Compound Name | 6-methoxy-3-N,3-N-dipropyl-1,2,3,4-tetrahydroquinoline-3,8-diamine |
|---|---|
| PubChem CID | 54370664 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 6-methoxy-3-N,3-N-dipropyl-1,2,3,4-tetrahydroquinoline-3,8-diamine |
| SMILES | CCCN(CCC)C1CNc2c(N)cc(OC)cc2C1 |
| InChI | InChI=1S/C16H27N3O/c1-4-6-19(7-5-2)13-8-12-9-14(20-3)10-15(17)16(12)18-11-13/h9-10,13,18H,4-8,11,17H2,1-3H3 |
| InChIKey | USYUMQJVQBGEIH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|