About 3-(2,5-diethoxyphenyl)prop-2-enenitrile
3-(2,5-diethoxyphenyl)prop-2-enenitrile (PubChem CID 54371745) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-(2,5-diethoxyphenyl)prop-2-enenitrile.
Molecular Properties
| Compound Name | 3-(2,5-diethoxyphenyl)prop-2-enenitrile |
| PubChem CID | 54371745 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 3-(2,5-diethoxyphenyl)prop-2-enenitrile |
| SMILES | CCOc1ccc(OCC)c(C=CC#N)c1 |
| InChI | InChI=1S/C13H15NO2/c1-3-15-12-7-8-13(16-4-2)11(10-12)6-5-9-14/h5-8,10H,3-4H2,1-2H3 |
| InChIKey | UTRNGBINFHKARA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-diethoxyphenyl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-diethoxyphenyl)prop-2-enenitrile?
The IUPAC name of 3-(2,5-diethoxyphenyl)prop-2-enenitrile (CID 54371745) is 3-(2,5-diethoxyphenyl)prop-2-enenitrile.
What is the SMILES notation for 3-(2,5-diethoxyphenyl)prop-2-enenitrile?
The canonical SMILES for 3-(2,5-diethoxyphenyl)prop-2-enenitrile is CCOc1ccc(OCC)c(C=CC#N)c1.
What is the InChIKey of 3-(2,5-diethoxyphenyl)prop-2-enenitrile?
The InChIKey is UTRNGBINFHKARA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-3-15-12-7-8-13(16-4-2)11(10-12)6-5-9-14/h5-8,10H,3-4H2,1-2H3.
What are the key properties of 3-(2,5-diethoxyphenyl)prop-2-enenitrile?
3-(2,5-diethoxyphenyl)prop-2-enenitrile has a molecular weight of 217.27 g/mol, XLogP of 3.02, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-diethoxyphenyl)prop-2-enenitrile is sourced from PubChem (CID 54371745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).