About 2-(diethylamino)ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate
2-(diethylamino)ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate (PubChem CID 54372010) has the molecular formula C46H90N2O4
and a molecular weight of 735.24 g/mol. Its IUPAC name is 2-(diethylamino)ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate |
| PubChem CID | 54372010 |
| Molecular Formula | C46H90N2O4 |
| Molecular Weight | 735.24 g/mol |
| Exact Mass | 734.69 |
| IUPAC Name | 2-(diethylamino)ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate |
| SMILES | CCCCCCCCC=CCCCCCCCCOCC(CNC(=O)OCCN(CC)CC)OCCCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C46H90N2O4/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-40-50-44-45(43-47-46(49)52-42-39-48(7-3)8-4)51-41-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2/h21-24,45H,5-20,25-44H2,1-4H3,(H,47,49) |
| InChIKey | UTWGXSHEJSPQOM-UHFFFAOYSA-N |
| XLogP | 13.53 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 735.24 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate?
The IUPAC name of 2-(diethylamino)ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate (CID 54372010) is 2-(diethylamino)ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate.
What is the SMILES notation for 2-(diethylamino)ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate?
The canonical SMILES for 2-(diethylamino)ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate is CCCCCCCCC=CCCCCCCCCOCC(CNC(=O)OCCN(CC)CC)OCCCCCCCCC=CCCCCCCCC.
What is the InChIKey of 2-(diethylamino)ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate?
The InChIKey is UTWGXSHEJSPQOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H90N2O4/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-40-50-44-45(43-47-46(49)52-42-39-48(7-3)8-4)51-41-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2/h21-24,45H,5-20,25-44H2,1-4H3,(H,47,49).
What are the key properties of 2-(diethylamino)ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate?
2-(diethylamino)ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate has a molecular weight of 735.24 g/mol, XLogP of 13.53, 42 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate is sourced from PubChem (CID 54372010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).