C12H8F3NO3 — CID 54372730
3-[4-(trifluoromethyl)phenoxy]-1H-pyrrole-2-carboxylic acid (PubChem CID 54372730) has the molecular formula C12H8F3NO3 and a molecular weight of 271.19 g/mol. Its IUPAC name is 3-[4-(trifluoromethyl)phenoxy]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3-[4-(trifluoromethyl)phenoxy]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 54372730 |
| Molecular Formula | C12H8F3NO3 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 3-[4-(trifluoromethyl)phenoxy]-1H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]ccc1Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H8F3NO3/c13-12(14,15)7-1-3-8(4-2-7)19-9-5-6-16-10(9)11(17)18/h1-6,16H,(H,17,18) |
| InChIKey | UUIVRPAXKVOMCH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |