About 2-(4-methyl-1,3-thiazol-2-yl)-1-phenylethanone
2-(4-methyl-1,3-thiazol-2-yl)-1-phenylethanone (PubChem CID 54372899) has the molecular formula C12H11NOS
and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)-1-phenylethanone.
Molecular Properties
| Compound Name | 2-(4-methyl-1,3-thiazol-2-yl)-1-phenylethanone |
| PubChem CID | 54372899 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-2-yl)-1-phenylethanone |
| SMILES | Cc1csc(CC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C12H11NOS/c1-9-8-15-12(13-9)7-11(14)10-5-3-2-4-6-10/h2-6,8H,7H2,1H3 |
| InChIKey | UULSCECBKCCRNB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methyl-1,3-thiazol-2-yl)-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)-1-phenylethanone?
The IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)-1-phenylethanone (CID 54372899) is 2-(4-methyl-1,3-thiazol-2-yl)-1-phenylethanone.
What is the SMILES notation for 2-(4-methyl-1,3-thiazol-2-yl)-1-phenylethanone?
The canonical SMILES for 2-(4-methyl-1,3-thiazol-2-yl)-1-phenylethanone is Cc1csc(CC(=O)c2ccccc2)n1.
What is the InChIKey of 2-(4-methyl-1,3-thiazol-2-yl)-1-phenylethanone?
The InChIKey is UULSCECBKCCRNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NOS/c1-9-8-15-12(13-9)7-11(14)10-5-3-2-4-6-10/h2-6,8H,7H2,1H3.
What are the key properties of 2-(4-methyl-1,3-thiazol-2-yl)-1-phenylethanone?
2-(4-methyl-1,3-thiazol-2-yl)-1-phenylethanone has a molecular weight of 217.29 g/mol, XLogP of 2.88, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,3-thiazol-2-yl)-1-phenylethanone is sourced from PubChem (CID 54372899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).