C11H22N4S2 — CID 54373121
N,N-dimethyl-3-(2,4,6-trimethylpiperazin-1-yl)-3H-1,2,4-dithiazol-5-amine (PubChem CID 54373121) has the molecular formula C11H22N4S2 and a molecular weight of 274.46 g/mol. Its IUPAC name is N,N-dimethyl-3-(2,4,6-trimethylpiperazin-1-yl)-3H-1,2,4-dithiazol-5-amine.
| Compound Name | N,N-dimethyl-3-(2,4,6-trimethylpiperazin-1-yl)-3H-1,2,4-dithiazol-5-amine |
|---|---|
| PubChem CID | 54373121 |
| Molecular Formula | C11H22N4S2 |
| Molecular Weight | 274.46 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N,N-dimethyl-3-(2,4,6-trimethylpiperazin-1-yl)-3H-1,2,4-dithiazol-5-amine |
| SMILES | CC1CN(C)CC(C)N1C1N=C(N(C)C)SS1 |
| InChI | InChI=1S/C11H22N4S2/c1-8-6-14(5)7-9(2)15(8)11-12-10(13(3)4)16-17-11/h8-9,11H,6-7H2,1-5H3 |
| InChIKey | UUPQCLCKFCPJPX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|