About 3-(7,8-dimethoxy-2H-chromen-5-yl)-2-(methoxymethyl)prop-2-enenitrile
3-(7,8-dimethoxy-2H-chromen-5-yl)-2-(methoxymethyl)prop-2-enenitrile (PubChem CID 54373447) has the molecular formula C16H17NO4
and a molecular weight of 287.32 g/mol. Its IUPAC name is 3-(7,8-dimethoxy-2H-chromen-5-yl)-2-(methoxymethyl)prop-2-enenitrile.
Molecular Properties
| Compound Name | 3-(7,8-dimethoxy-2H-chromen-5-yl)-2-(methoxymethyl)prop-2-enenitrile |
| PubChem CID | 54373447 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3-(7,8-dimethoxy-2H-chromen-5-yl)-2-(methoxymethyl)prop-2-enenitrile |
| SMILES | COCC(C#N)=Cc1cc(OC)c(OC)c2c1C=CCO2 |
| InChI | InChI=1S/C16H17NO4/c1-18-10-11(9-17)7-12-8-14(19-2)16(20-3)15-13(12)5-4-6-21-15/h4-5,7-8H,6,10H2,1-3H3 |
| InChIKey | UUVGOTJBHRZFFI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(7,8-dimethoxy-2H-chromen-5-yl)-2-(methoxymethyl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7,8-dimethoxy-2H-chromen-5-yl)-2-(methoxymethyl)prop-2-enenitrile?
The IUPAC name of 3-(7,8-dimethoxy-2H-chromen-5-yl)-2-(methoxymethyl)prop-2-enenitrile (CID 54373447) is 3-(7,8-dimethoxy-2H-chromen-5-yl)-2-(methoxymethyl)prop-2-enenitrile.
What is the SMILES notation for 3-(7,8-dimethoxy-2H-chromen-5-yl)-2-(methoxymethyl)prop-2-enenitrile?
The canonical SMILES for 3-(7,8-dimethoxy-2H-chromen-5-yl)-2-(methoxymethyl)prop-2-enenitrile is COCC(C#N)=Cc1cc(OC)c(OC)c2c1C=CCO2.
What is the InChIKey of 3-(7,8-dimethoxy-2H-chromen-5-yl)-2-(methoxymethyl)prop-2-enenitrile?
The InChIKey is UUVGOTJBHRZFFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO4/c1-18-10-11(9-17)7-12-8-14(19-2)16(20-3)15-13(12)5-4-6-21-15/h4-5,7-8H,6,10H2,1-3H3.
What are the key properties of 3-(7,8-dimethoxy-2H-chromen-5-yl)-2-(methoxymethyl)prop-2-enenitrile?
3-(7,8-dimethoxy-2H-chromen-5-yl)-2-(methoxymethyl)prop-2-enenitrile has a molecular weight of 287.32 g/mol, XLogP of 2.66, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7,8-dimethoxy-2H-chromen-5-yl)-2-(methoxymethyl)prop-2-enenitrile is sourced from PubChem (CID 54373447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).