About 4-[2-(1,3-thiazol-4-yl)benzimidazole-1-carbonyl]oxyoctanoic acid
4-[2-(1,3-thiazol-4-yl)benzimidazole-1-carbonyl]oxyoctanoic acid (PubChem CID 54373565) has the molecular formula C19H21N3O4S
and a molecular weight of 387.46 g/mol. Its IUPAC name is 4-[2-(1,3-thiazol-4-yl)benzimidazole-1-carbonyl]oxyoctanoic acid.
Molecular Properties
| Compound Name | 4-[2-(1,3-thiazol-4-yl)benzimidazole-1-carbonyl]oxyoctanoic acid |
| PubChem CID | 54373565 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-[2-(1,3-thiazol-4-yl)benzimidazole-1-carbonyl]oxyoctanoic acid |
| SMILES | CCCCC(CCC(=O)O)OC(=O)n1c(-c2cscn2)nc2ccccc21 |
| InChI | InChI=1S/C19H21N3O4S/c1-2-3-6-13(9-10-17(23)24)26-19(25)22-16-8-5-4-7-14(16)21-18(22)15-11-27-12-20-15/h4-5,7-8,11-13H,2-3,6,9-10H2,1H3,(H,23,24) |
| InChIKey | UUXHSFOKCADTAT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[2-(1,3-thiazol-4-yl)benzimidazole-1-carbonyl]oxyoctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,3-thiazol-4-yl)benzimidazole-1-carbonyl]oxyoctanoic acid?
The IUPAC name of 4-[2-(1,3-thiazol-4-yl)benzimidazole-1-carbonyl]oxyoctanoic acid (CID 54373565) is 4-[2-(1,3-thiazol-4-yl)benzimidazole-1-carbonyl]oxyoctanoic acid.
What is the SMILES notation for 4-[2-(1,3-thiazol-4-yl)benzimidazole-1-carbonyl]oxyoctanoic acid?
The canonical SMILES for 4-[2-(1,3-thiazol-4-yl)benzimidazole-1-carbonyl]oxyoctanoic acid is CCCCC(CCC(=O)O)OC(=O)n1c(-c2cscn2)nc2ccccc21.
What is the InChIKey of 4-[2-(1,3-thiazol-4-yl)benzimidazole-1-carbonyl]oxyoctanoic acid?
The InChIKey is UUXHSFOKCADTAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O4S/c1-2-3-6-13(9-10-17(23)24)26-19(25)22-16-8-5-4-7-14(16)21-18(22)15-11-27-12-20-15/h4-5,7-8,11-13H,2-3,6,9-10H2,1H3,(H,23,24).
What are the key properties of 4-[2-(1,3-thiazol-4-yl)benzimidazole-1-carbonyl]oxyoctanoic acid?
4-[2-(1,3-thiazol-4-yl)benzimidazole-1-carbonyl]oxyoctanoic acid has a molecular weight of 387.46 g/mol, XLogP of 4.57, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3-thiazol-4-yl)benzimidazole-1-carbonyl]oxyoctanoic acid is sourced from PubChem (CID 54373565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).