C15H18F10N2O4 — CID 543740
ethyl 3-[2,2,3,3,3-pentafluoropropanoyl-[4-(2,2,3,3,3-pentafluoropropanoylamino)butyl]amino]propanoate (PubChem CID 543740) has the molecular formula C15H18F10N2O4 and a molecular weight of 480.30 g/mol. Its IUPAC name is ethyl 3-[2,2,3,3,3-pentafluoropropanoyl-[4-(2,2,3,3,3-pentafluoropropanoylamino)butyl]amino]propanoate.
| Compound Name | ethyl 3-[2,2,3,3,3-pentafluoropropanoyl-[4-(2,2,3,3,3-pentafluoropropanoylamino)butyl]amino]propanoate |
|---|---|
| PubChem CID | 543740 |
| Molecular Formula | C15H18F10N2O4 |
| Molecular Weight | 480.30 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | ethyl 3-[2,2,3,3,3-pentafluoropropanoyl-[4-(2,2,3,3,3-pentafluoropropanoylamino)butyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(CCCCNC(=O)C(F)(F)C(F)(F)F)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H18F10N2O4/c1-2-31-9(28)5-8-27(11(30)13(18,19)15(23,24)25)7-4-3-6-26-10(29)12(16,17)14(20,21)22/h2-8H2,1H3,(H,26,29) |
| InChIKey | DQPHUSTXQNOBON-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|