About 7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanamide
7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanamide (PubChem CID 54374402) has the molecular formula C22H24N2OS2
and a molecular weight of 396.58 g/mol. Its IUPAC name is 7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanamide.
Molecular Properties
| Compound Name | 7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanamide |
| PubChem CID | 54374402 |
| Molecular Formula | C22H24N2OS2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanamide |
| SMILES | NC(=O)CCCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C22H24N2OS2/c23-19(25)15-9-1-2-10-16-26-22-24-20(17-11-5-3-6-12-17)21(27-22)18-13-7-4-8-14-18/h3-8,11-14H,1-2,9-10,15-16H2,(H2,23,25) |
| InChIKey | UVLQAQVPMFWYFP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanamide?
The IUPAC name of 7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanamide (CID 54374402) is 7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanamide.
What is the SMILES notation for 7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanamide?
The canonical SMILES for 7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanamide is NC(=O)CCCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)s1.
What is the InChIKey of 7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanamide?
The InChIKey is UVLQAQVPMFWYFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2OS2/c23-19(25)15-9-1-2-10-16-26-22-24-20(17-11-5-3-6-12-17)21(27-22)18-13-7-4-8-14-18/h3-8,11-14H,1-2,9-10,15-16H2,(H2,23,25).
What are the key properties of 7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanamide?
7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanamide has a molecular weight of 396.58 g/mol, XLogP of 6.01, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]heptanamide is sourced from PubChem (CID 54374402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).