C23H22F3N3O2 — CID 54374768
N-[4-benzyl-3-(2,2,2-trifluoroacetyl)piperidin-1-yl]-1H-indole-6-carboxamide (PubChem CID 54374768) has the molecular formula C23H22F3N3O2 and a molecular weight of 429.44 g/mol. Its IUPAC name is N-[4-benzyl-3-(2,2,2-trifluoroacetyl)piperidin-1-yl]-1H-indole-6-carboxamide.
| Compound Name | N-[4-benzyl-3-(2,2,2-trifluoroacetyl)piperidin-1-yl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 54374768 |
| Molecular Formula | C23H22F3N3O2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-[4-benzyl-3-(2,2,2-trifluoroacetyl)piperidin-1-yl]-1H-indole-6-carboxamide |
| SMILES | O=C(NN1CCC(Cc2ccccc2)C(C(=O)C(F)(F)F)C1)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C23H22F3N3O2/c24-23(25,26)21(30)19-14-29(11-9-17(19)12-15-4-2-1-3-5-15)28-22(31)18-7-6-16-8-10-27-20(16)13-18/h1-8,10,13,17,19,27H,9,11-12,14H2,(H,28,31) |
| InChIKey | UVSLRAUFIPREAQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |