C30H29FN3O7S3+ — CID 54374929
2-[2-[2-[[5-fluoro-3-[2-(methanesulfonamido)-2-oxoethyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonic acid (PubChem CID 54374929) has the molecular formula C30H29FN3O7S3+ and a molecular weight of 658.78 g/mol. Its IUPAC name is 2-[2-[2-[[5-fluoro-3-[2-(methanesulfonamido)-2-oxoethyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonic acid.
| Compound Name | 2-[2-[2-[[5-fluoro-3-[2-(methanesulfonamido)-2-oxoethyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 54374929 |
| Molecular Formula | C30H29FN3O7S3+ |
| Molecular Weight | 658.78 g/mol |
| Exact Mass | 658.11 |
| IUPAC Name | 2-[2-[2-[[5-fluoro-3-[2-(methanesulfonamido)-2-oxoethyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonic acid |
| SMILES | CCC(=Cc1sc2ccc(F)cc2[n+]1CC(=O)NS(C)(=O)=O)C=C1Oc2ccc(-c3ccccc3)cc2N1CCS(=O)(=O)O |
| InChI | InChI=1S/C30H28FN3O7S3/c1-3-20(16-30-34(19-28(35)32-43(2,36)37)25-18-23(31)10-12-27(25)42-30)15-29-33(13-14-44(38,39)40)24-17-22(9-11-26(24)41-29)21-7-5-4-6-8-21/h4-12,15-18H,3,13-14,19H2,1-2H3,(H-,32,35,38,39,40)/p+1 |
| InChIKey | UVVCCVSJFTWIFO-UHFFFAOYSA-O |
| XLogP | 4.49 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.78 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|