About (3-bromo-2-chlorophenyl) dihydrogen phosphate
(3-bromo-2-chlorophenyl) dihydrogen phosphate (PubChem CID 54375223) has the molecular formula C6H5BrClO4P
and a molecular weight of 287.43 g/mol. Its IUPAC name is (3-bromo-2-chlorophenyl) dihydrogen phosphate.
Molecular Properties
| Compound Name | (3-bromo-2-chlorophenyl) dihydrogen phosphate |
| PubChem CID | 54375223 |
| Molecular Formula | C6H5BrClO4P |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 285.88 |
| IUPAC Name | (3-bromo-2-chlorophenyl) dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1cccc(Br)c1Cl |
| InChI | InChI=1S/C6H5BrClO4P/c7-4-2-1-3-5(6(4)8)12-13(9,10)11/h1-3H,(H2,9,10,11) |
| InChIKey | UWAFTVOXQNGLPS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-bromo-2-chlorophenyl) dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-2-chlorophenyl) dihydrogen phosphate?
The IUPAC name of (3-bromo-2-chlorophenyl) dihydrogen phosphate (CID 54375223) is (3-bromo-2-chlorophenyl) dihydrogen phosphate.
What is the SMILES notation for (3-bromo-2-chlorophenyl) dihydrogen phosphate?
The canonical SMILES for (3-bromo-2-chlorophenyl) dihydrogen phosphate is O=P(O)(O)Oc1cccc(Br)c1Cl.
What is the InChIKey of (3-bromo-2-chlorophenyl) dihydrogen phosphate?
The InChIKey is UWAFTVOXQNGLPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrClO4P/c7-4-2-1-3-5(6(4)8)12-13(9,10)11/h1-3H,(H2,9,10,11).
What are the key properties of (3-bromo-2-chlorophenyl) dihydrogen phosphate?
(3-bromo-2-chlorophenyl) dihydrogen phosphate has a molecular weight of 287.43 g/mol, XLogP of 2.57, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-2-chlorophenyl) dihydrogen phosphate is sourced from PubChem (CID 54375223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).