About 1,6-bis(ethenyl)-1,3-diazinan-2-one
1,6-bis(ethenyl)-1,3-diazinan-2-one (PubChem CID 54375708) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 1,6-bis(ethenyl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1,6-bis(ethenyl)-1,3-diazinan-2-one |
| PubChem CID | 54375708 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 1,6-bis(ethenyl)-1,3-diazinan-2-one |
| SMILES | C=CC1CCNC(=O)N1C=C |
| InChI | InChI=1S/C8H12N2O/c1-3-7-5-6-9-8(11)10(7)4-2/h3-4,7H,1-2,5-6H2,(H,9,11) |
| InChIKey | UWIUCSWMHYVTGQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,6-bis(ethenyl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-bis(ethenyl)-1,3-diazinan-2-one?
The IUPAC name of 1,6-bis(ethenyl)-1,3-diazinan-2-one (CID 54375708) is 1,6-bis(ethenyl)-1,3-diazinan-2-one.
What is the SMILES notation for 1,6-bis(ethenyl)-1,3-diazinan-2-one?
The canonical SMILES for 1,6-bis(ethenyl)-1,3-diazinan-2-one is C=CC1CCNC(=O)N1C=C.
What is the InChIKey of 1,6-bis(ethenyl)-1,3-diazinan-2-one?
The InChIKey is UWIUCSWMHYVTGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-3-7-5-6-9-8(11)10(7)4-2/h3-4,7H,1-2,5-6H2,(H,9,11).
What are the key properties of 1,6-bis(ethenyl)-1,3-diazinan-2-one?
1,6-bis(ethenyl)-1,3-diazinan-2-one has a molecular weight of 152.20 g/mol, XLogP of 1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-bis(ethenyl)-1,3-diazinan-2-one is sourced from PubChem (CID 54375708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).