C22H29N3O7S2 — CID 54376104
[1-ethyl-4-(4-methoxyimino-5,8-dimethyl-1,1-dioxo-2,3-dihydrothiochromene-2-carbonyl)pyrazol-5-yl] butane-1-sulfonate (PubChem CID 54376104) has the molecular formula C22H29N3O7S2 and a molecular weight of 511.62 g/mol. Its IUPAC name is [1-ethyl-4-(4-methoxyimino-5,8-dimethyl-1,1-dioxo-2,3-dihydrothiochromene-2-carbonyl)pyrazol-5-yl] butane-1-sulfonate.
| Compound Name | [1-ethyl-4-(4-methoxyimino-5,8-dimethyl-1,1-dioxo-2,3-dihydrothiochromene-2-carbonyl)pyrazol-5-yl] butane-1-sulfonate |
|---|---|
| PubChem CID | 54376104 |
| Molecular Formula | C22H29N3O7S2 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | [1-ethyl-4-(4-methoxyimino-5,8-dimethyl-1,1-dioxo-2,3-dihydrothiochromene-2-carbonyl)pyrazol-5-yl] butane-1-sulfonate |
| SMILES | CCCCS(=O)(=O)Oc1c(C(=O)C2CC(=NOC)c3c(C)ccc(C)c3S2(=O)=O)cnn1CC |
| InChI | InChI=1S/C22H29N3O7S2/c1-6-8-11-33(27,28)32-22-16(13-23-25(22)7-2)20(26)18-12-17(24-31-5)19-14(3)9-10-15(4)21(19)34(18,29)30/h9-10,13,18H,6-8,11-12H2,1-5H3 |
| InChIKey | UWOVYLKPEDBELH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 133.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|