benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate

C14H17F3O4S — CID 54376285

IUPACbenzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate
SMILESCC(C)(C)[C@@H](C(=O)OCc1ccccc1)S(=O)(=O)C(F)(F)F
InChIInChI=1S/C14H17F3O4S/c1-13(2,3)11(22(19,20)14(15,16)17)12(18)21-9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3/t11-/m1/s1
InChIKeyUWSOAZPKWOKWPI-LLVKDONJSA-N
MW338.35 g/mol
LogP3.08
Rot. Bonds4

About benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate

benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate (PubChem CID 54376285) has the molecular formula C14H17F3O4S and a molecular weight of 338.35 g/mol. Its IUPAC name is benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate.

Molecular Properties

Compound Namebenzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate
PubChem CID54376285
Molecular FormulaC14H17F3O4S
Molecular Weight338.35 g/mol
Exact Mass338.08
IUPAC Namebenzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate
SMILESCC(C)(C)[C@@H](C(=O)OCc1ccccc1)S(=O)(=O)C(F)(F)F
InChIInChI=1S/C14H17F3O4S/c1-13(2,3)11(22(19,20)14(15,16)17)12(18)21-9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3/t11-/m1/s1
InChIKeyUWSOAZPKWOKWPI-LLVKDONJSA-N
XLogP3.08
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500338.35
LogP ≤ 53.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate?
The IUPAC name of benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate (CID 54376285) is benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate.
What is the SMILES notation for benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate?
The canonical SMILES for benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate is CC(C)(C)[C@@H](C(=O)OCc1ccccc1)S(=O)(=O)C(F)(F)F.
What is the InChIKey of benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate?
The InChIKey is UWSOAZPKWOKWPI-LLVKDONJSA-N. The full InChI is InChI=1S/C14H17F3O4S/c1-13(2,3)11(22(19,20)14(15,16)17)12(18)21-9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3/t11-/m1/s1.
What are the key properties of benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate?
benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate has a molecular weight of 338.35 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate is sourced from PubChem (CID 54376285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).