About benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate
benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate (PubChem CID 54376285) has the molecular formula C14H17F3O4S
and a molecular weight of 338.35 g/mol. Its IUPAC name is benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate.
Molecular Properties
| Compound Name | benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate |
| PubChem CID | 54376285 |
| Molecular Formula | C14H17F3O4S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate |
| SMILES | CC(C)(C)[C@@H](C(=O)OCc1ccccc1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H17F3O4S/c1-13(2,3)11(22(19,20)14(15,16)17)12(18)21-9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3/t11-/m1/s1 |
| InChIKey | UWSOAZPKWOKWPI-LLVKDONJSA-N |
| XLogP | 3.08 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate?
The IUPAC name of benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate (CID 54376285) is benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate.
What is the SMILES notation for benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate?
The canonical SMILES for benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate is CC(C)(C)[C@@H](C(=O)OCc1ccccc1)S(=O)(=O)C(F)(F)F.
What is the InChIKey of benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate?
The InChIKey is UWSOAZPKWOKWPI-LLVKDONJSA-N. The full InChI is InChI=1S/C14H17F3O4S/c1-13(2,3)11(22(19,20)14(15,16)17)12(18)21-9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3/t11-/m1/s1.
What are the key properties of benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate?
benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate has a molecular weight of 338.35 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoate is sourced from PubChem (CID 54376285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).