About 6H-[1,4]dithiepino[6,5-b]pyridine
6H-[1,4]dithiepino[6,5-b]pyridine (PubChem CID 54376309) has the molecular formula C8H7NS2
and a molecular weight of 181.29 g/mol. Its IUPAC name is 6H-[1,4]dithiepino[6,5-b]pyridine.
Molecular Properties
| Compound Name | 6H-[1,4]dithiepino[6,5-b]pyridine |
| PubChem CID | 54376309 |
| Molecular Formula | C8H7NS2 |
| Molecular Weight | 181.29 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 6H-[1,4]dithiepino[6,5-b]pyridine |
| SMILES | c1c[nH]c2csccsc-2c1 |
| InChI | InChI=1S/C8H7NS2/c1-2-8-7(9-3-1)6-10-4-5-11-8/h1-6,9H |
| InChIKey | UWSVIEYEOLLVFQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6H-[1,4]dithiepino[6,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-[1,4]dithiepino[6,5-b]pyridine?
The IUPAC name of 6H-[1,4]dithiepino[6,5-b]pyridine (CID 54376309) is 6H-[1,4]dithiepino[6,5-b]pyridine.
What is the SMILES notation for 6H-[1,4]dithiepino[6,5-b]pyridine?
The canonical SMILES for 6H-[1,4]dithiepino[6,5-b]pyridine is c1c[nH]c2csccsc-2c1.
What is the InChIKey of 6H-[1,4]dithiepino[6,5-b]pyridine?
The InChIKey is UWSVIEYEOLLVFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS2/c1-2-8-7(9-3-1)6-10-4-5-11-8/h1-6,9H.
What are the key properties of 6H-[1,4]dithiepino[6,5-b]pyridine?
6H-[1,4]dithiepino[6,5-b]pyridine has a molecular weight of 181.29 g/mol, XLogP of 3.37, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-[1,4]dithiepino[6,5-b]pyridine is sourced from PubChem (CID 54376309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).