C15H25N5O6 — CID 54376401
(2,5-dihydroxypyrrol-1-yl) (2R)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 54376401) has the molecular formula C15H25N5O6 and a molecular weight of 371.39 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2R)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2R)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 54376401 |
| Molecular Formula | C15H25N5O6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2R)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCN=C(N)N)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C15H25N5O6/c1-15(2,3)25-14(24)19-9(5-4-8-18-13(16)17)12(23)26-20-10(21)6-7-11(20)22/h6-7,9,21-22H,4-5,8H2,1-3H3,(H,19,24)(H4,16,17,18)/t9-/m1/s1 |
| InChIKey | UWUNTGDFPXPMLS-SECBINFHSA-N |
| XLogP | -0.20 |
| TPSA | 174.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|