C21H25NO — CID 54376655
2-[[4-(2-phenylethenyl)phenyl]methoxy]cyclohexan-1-amine (PubChem CID 54376655) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-[[4-(2-phenylethenyl)phenyl]methoxy]cyclohexan-1-amine.
| Compound Name | 2-[[4-(2-phenylethenyl)phenyl]methoxy]cyclohexan-1-amine |
|---|---|
| PubChem CID | 54376655 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2-[[4-(2-phenylethenyl)phenyl]methoxy]cyclohexan-1-amine |
| SMILES | NC1CCCCC1OCc1ccc(C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NO/c22-20-8-4-5-9-21(20)23-16-19-14-12-18(13-15-19)11-10-17-6-2-1-3-7-17/h1-3,6-7,10-15,20-21H,4-5,8-9,16,22H2 |
| InChIKey | UWZDYYDUNZPTIV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|