C18H22O4 — CID 54376869
1,1-di(cyclopenta-1,3-dien-1-yloxy)butyl 2-methylprop-2-enoate (PubChem CID 54376869) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 1,1-di(cyclopenta-1,3-dien-1-yloxy)butyl 2-methylprop-2-enoate.
| Compound Name | 1,1-di(cyclopenta-1,3-dien-1-yloxy)butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54376869 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1,1-di(cyclopenta-1,3-dien-1-yloxy)butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCC)(OC1=CC=CC1)OC1=CC=CC1 |
| InChI | InChI=1S/C18H22O4/c1-4-13-18(22-17(19)14(2)3,20-15-9-5-6-10-15)21-16-11-7-8-12-16/h5-9,11H,2,4,10,12-13H2,1,3H3 |
| InChIKey | UXDDWJHCMWKLHP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|