About 2-[(2,4-disulfophenyl)methyl]-3-oxo-1H-pyrazole-5-carboxylic acid
2-[(2,4-disulfophenyl)methyl]-3-oxo-1H-pyrazole-5-carboxylic acid (PubChem CID 54377077) has the molecular formula C11H10N2O9S2
and a molecular weight of 378.34 g/mol. Its IUPAC name is 2-[(2,4-disulfophenyl)methyl]-3-oxo-1H-pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(2,4-disulfophenyl)methyl]-3-oxo-1H-pyrazole-5-carboxylic acid |
| PubChem CID | 54377077 |
| Molecular Formula | C11H10N2O9S2 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 2-[(2,4-disulfophenyl)methyl]-3-oxo-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)n(Cc2ccc(S(=O)(=O)O)cc2S(=O)(=O)O)[nH]1 |
| InChI | InChI=1S/C11H10N2O9S2/c14-10-4-8(11(15)16)12-13(10)5-6-1-2-7(23(17,18)19)3-9(6)24(20,21)22/h1-4,12H,5H2,(H,15,16)(H,17,18,19)(H,20,21,22) |
| InChIKey | UXGQWWMINMJMET-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 183.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,4-disulfophenyl)methyl]-3-oxo-1H-pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-disulfophenyl)methyl]-3-oxo-1H-pyrazole-5-carboxylic acid?
The IUPAC name of 2-[(2,4-disulfophenyl)methyl]-3-oxo-1H-pyrazole-5-carboxylic acid (CID 54377077) is 2-[(2,4-disulfophenyl)methyl]-3-oxo-1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for 2-[(2,4-disulfophenyl)methyl]-3-oxo-1H-pyrazole-5-carboxylic acid?
The canonical SMILES for 2-[(2,4-disulfophenyl)methyl]-3-oxo-1H-pyrazole-5-carboxylic acid is O=C(O)c1cc(=O)n(Cc2ccc(S(=O)(=O)O)cc2S(=O)(=O)O)[nH]1.
What is the InChIKey of 2-[(2,4-disulfophenyl)methyl]-3-oxo-1H-pyrazole-5-carboxylic acid?
The InChIKey is UXGQWWMINMJMET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O9S2/c14-10-4-8(11(15)16)12-13(10)5-6-1-2-7(23(17,18)19)3-9(6)24(20,21)22/h1-4,12H,5H2,(H,15,16)(H,17,18,19)(H,20,21,22).
What are the key properties of 2-[(2,4-disulfophenyl)methyl]-3-oxo-1H-pyrazole-5-carboxylic acid?
2-[(2,4-disulfophenyl)methyl]-3-oxo-1H-pyrazole-5-carboxylic acid has a molecular weight of 378.34 g/mol, XLogP of -0.58, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-disulfophenyl)methyl]-3-oxo-1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 54377077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).