About 4-(1H-imidazo[4,5-b]pyrazin-2-yl)-2-methoxybenzene-1,3-dicarbonitrile
4-(1H-imidazo[4,5-b]pyrazin-2-yl)-2-methoxybenzene-1,3-dicarbonitrile (PubChem CID 54377257) has the molecular formula C14H8N6O
and a molecular weight of 276.26 g/mol. Its IUPAC name is 4-(1H-imidazo[4,5-b]pyrazin-2-yl)-2-methoxybenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 4-(1H-imidazo[4,5-b]pyrazin-2-yl)-2-methoxybenzene-1,3-dicarbonitrile |
| PubChem CID | 54377257 |
| Molecular Formula | C14H8N6O |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-(1H-imidazo[4,5-b]pyrazin-2-yl)-2-methoxybenzene-1,3-dicarbonitrile |
| SMILES | COc1c(C#N)ccc(-c2nc3nccnc3[nH]2)c1C#N |
| InChI | InChI=1S/C14H8N6O/c1-21-11-8(6-15)2-3-9(10(11)7-16)12-19-13-14(20-12)18-5-4-17-13/h2-5H,1H3,(H,17,18,19,20) |
| InChIKey | UXKCQQAVVCDKMN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1H-imidazo[4,5-b]pyrazin-2-yl)-2-methoxybenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-imidazo[4,5-b]pyrazin-2-yl)-2-methoxybenzene-1,3-dicarbonitrile?
The IUPAC name of 4-(1H-imidazo[4,5-b]pyrazin-2-yl)-2-methoxybenzene-1,3-dicarbonitrile (CID 54377257) is 4-(1H-imidazo[4,5-b]pyrazin-2-yl)-2-methoxybenzene-1,3-dicarbonitrile.
What is the SMILES notation for 4-(1H-imidazo[4,5-b]pyrazin-2-yl)-2-methoxybenzene-1,3-dicarbonitrile?
The canonical SMILES for 4-(1H-imidazo[4,5-b]pyrazin-2-yl)-2-methoxybenzene-1,3-dicarbonitrile is COc1c(C#N)ccc(-c2nc3nccnc3[nH]2)c1C#N.
What is the InChIKey of 4-(1H-imidazo[4,5-b]pyrazin-2-yl)-2-methoxybenzene-1,3-dicarbonitrile?
The InChIKey is UXKCQQAVVCDKMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N6O/c1-21-11-8(6-15)2-3-9(10(11)7-16)12-19-13-14(20-12)18-5-4-17-13/h2-5H,1H3,(H,17,18,19,20).
What are the key properties of 4-(1H-imidazo[4,5-b]pyrazin-2-yl)-2-methoxybenzene-1,3-dicarbonitrile?
4-(1H-imidazo[4,5-b]pyrazin-2-yl)-2-methoxybenzene-1,3-dicarbonitrile has a molecular weight of 276.26 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-imidazo[4,5-b]pyrazin-2-yl)-2-methoxybenzene-1,3-dicarbonitrile is sourced from PubChem (CID 54377257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).