C26H34FNO2 — CID 54377297
1-[3-fluoro-4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]-5,9-dimethyldeca-2,4,8-trien-1-one (PubChem CID 54377297) has the molecular formula C26H34FNO2 and a molecular weight of 411.56 g/mol. Its IUPAC name is 1-[3-fluoro-4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]-5,9-dimethyldeca-2,4,8-trien-1-one.
| Compound Name | 1-[3-fluoro-4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]-5,9-dimethyldeca-2,4,8-trien-1-one |
|---|---|
| PubChem CID | 54377297 |
| Molecular Formula | C26H34FNO2 |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 1-[3-fluoro-4-[4-[methyl(prop-2-enyl)amino]but-2-enoxy]phenyl]-5,9-dimethyldeca-2,4,8-trien-1-one |
| SMILES | C=CCN(C)CC=CCOc1ccc(C(=O)C=CC=C(C)CCC=C(C)C)cc1F |
| InChI | InChI=1S/C26H34FNO2/c1-6-17-28(5)18-7-8-19-30-26-16-15-23(20-24(26)27)25(29)14-10-13-22(4)12-9-11-21(2)3/h6-8,10-11,13-16,20H,1,9,12,17-19H2,2-5H3 |
| InChIKey | UXKULWUWWGIIQL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|