methyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate

C15H25N3O2 — CID 54377511

IUPACmethyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate
SMILESCOC(=O)CCCCn1nc(C)nc1C1CCCCC1
InChIInChI=1S/C15H25N3O2/c1-12-16-15(13-8-4-3-5-9-13)18(17-12)11-7-6-10-14(19)20-2/h13H,3-11H2,1-2H3
InChIKeyUXOPUGBMLSDXNS-UHFFFAOYSA-N
MW279.38 g/mol
LogP2.98
Rot. Bonds6

About methyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate

methyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate (PubChem CID 54377511) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is methyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate.

Molecular Properties

Compound Namemethyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate
PubChem CID54377511
Molecular FormulaC15H25N3O2
Molecular Weight279.38 g/mol
Exact Mass279.19
IUPAC Namemethyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate
SMILESCOC(=O)CCCCn1nc(C)nc1C1CCCCC1
InChIInChI=1S/C15H25N3O2/c1-12-16-15(13-8-4-3-5-9-13)18(17-12)11-7-6-10-14(19)20-2/h13H,3-11H2,1-2H3
InChIKeyUXOPUGBMLSDXNS-UHFFFAOYSA-N
XLogP2.98
TPSA57.01 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.38
LogP ≤ 52.98
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate?
The IUPAC name of methyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate (CID 54377511) is methyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate.
What is the SMILES notation for methyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate?
The canonical SMILES for methyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate is COC(=O)CCCCn1nc(C)nc1C1CCCCC1.
What is the InChIKey of methyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate?
The InChIKey is UXOPUGBMLSDXNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O2/c1-12-16-15(13-8-4-3-5-9-13)18(17-12)11-7-6-10-14(19)20-2/h13H,3-11H2,1-2H3.
What are the key properties of methyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate?
methyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate has a molecular weight of 279.38 g/mol, XLogP of 2.98, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(5-cyclohexyl-3-methyl-1,2,4-triazol-1-yl)pentanoate is sourced from PubChem (CID 54377511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).