C32H36O6S — CID 54377529
methyl 2-[(4S)-7-methoxy-7-oxo-1-[4-(4-phenoxybutoxy)phenyl]hept-2-en-4-yl]sulfanylbenzoate (PubChem CID 54377529) has the molecular formula C32H36O6S and a molecular weight of 548.70 g/mol. Its IUPAC name is methyl 2-[(4S)-7-methoxy-7-oxo-1-[4-(4-phenoxybutoxy)phenyl]hept-2-en-4-yl]sulfanylbenzoate.
| Compound Name | methyl 2-[(4S)-7-methoxy-7-oxo-1-[4-(4-phenoxybutoxy)phenyl]hept-2-en-4-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 54377529 |
| Molecular Formula | C32H36O6S |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | methyl 2-[(4S)-7-methoxy-7-oxo-1-[4-(4-phenoxybutoxy)phenyl]hept-2-en-4-yl]sulfanylbenzoate |
| SMILES | COC(=O)CC[C@@H](C=CCc1ccc(OCCCCOc2ccccc2)cc1)Sc1ccccc1C(=O)OC |
| InChI | InChI=1S/C32H36O6S/c1-35-31(33)22-21-28(39-30-16-7-6-15-29(30)32(34)36-2)14-10-11-25-17-19-27(20-18-25)38-24-9-8-23-37-26-12-4-3-5-13-26/h3-7,10,12-20,28H,8-9,11,21-24H2,1-2H3/t28-/m1/s1 |
| InChIKey | UXPBVICHIQGAHL-MUUNZHRXSA-N |
| XLogP | 6.92 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|