2-ethyl-3-oxohex-4-enoic acid

C8H12O3 — CID 54377673

IUPAC2-ethyl-3-oxohex-4-enoic acid
SMILESCC=CC(=O)C(CC)C(=O)O
InChIInChI=1S/C8H12O3/c1-3-5-7(9)6(4-2)8(10)11/h3,5-6H,4H2,1-2H3,(H,10,11)
InChIKeyUXSCMRUSKWWPFV-UHFFFAOYSA-N
MW156.18 g/mol
LogP1.24
Rot. Bonds4

About 2-ethyl-3-oxohex-4-enoic acid

2-ethyl-3-oxohex-4-enoic acid (PubChem CID 54377673) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-ethyl-3-oxohex-4-enoic acid.

Molecular Properties

Compound Name2-ethyl-3-oxohex-4-enoic acid
PubChem CID54377673
Molecular FormulaC8H12O3
Molecular Weight156.18 g/mol
Exact Mass156.08
IUPAC Name2-ethyl-3-oxohex-4-enoic acid
SMILESCC=CC(=O)C(CC)C(=O)O
InChIInChI=1S/C8H12O3/c1-3-5-7(9)6(4-2)8(10)11/h3,5-6H,4H2,1-2H3,(H,10,11)
InChIKeyUXSCMRUSKWWPFV-UHFFFAOYSA-N
XLogP1.24
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.18
LogP ≤ 51.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-ethyl-3-oxohex-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-3-oxohex-4-enoic acid?
The IUPAC name of 2-ethyl-3-oxohex-4-enoic acid (CID 54377673) is 2-ethyl-3-oxohex-4-enoic acid.
What is the SMILES notation for 2-ethyl-3-oxohex-4-enoic acid?
The canonical SMILES for 2-ethyl-3-oxohex-4-enoic acid is CC=CC(=O)C(CC)C(=O)O.
What is the InChIKey of 2-ethyl-3-oxohex-4-enoic acid?
The InChIKey is UXSCMRUSKWWPFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-3-5-7(9)6(4-2)8(10)11/h3,5-6H,4H2,1-2H3,(H,10,11).
What are the key properties of 2-ethyl-3-oxohex-4-enoic acid?
2-ethyl-3-oxohex-4-enoic acid has a molecular weight of 156.18 g/mol, XLogP of 1.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-oxohex-4-enoic acid is sourced from PubChem (CID 54377673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).