About 1,2-dimethylguanidine;ethane
1,2-dimethylguanidine;ethane (PubChem CID 54378223) has the molecular formula C5H15N3
and a molecular weight of 117.20 g/mol. Its IUPAC name is 1,2-dimethylguanidine;ethane.
Molecular Properties
| Compound Name | 1,2-dimethylguanidine;ethane |
| PubChem CID | 54378223 |
| Molecular Formula | C5H15N3 |
| Molecular Weight | 117.20 g/mol |
| Exact Mass | 117.13 |
| IUPAC Name | 1,2-dimethylguanidine;ethane |
| SMILES | C/N=C(\N)NC.CC |
| InChI | InChI=1S/C3H9N3.C2H6/c1-5-3(4)6-2;1-2/h1-2H3,(H3,4,5,6);1-2H3 |
| InChIKey | UYBMXSXQGMUTNA-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylguanidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylguanidine;ethane?
The IUPAC name of 1,2-dimethylguanidine;ethane (CID 54378223) is 1,2-dimethylguanidine;ethane.
What is the SMILES notation for 1,2-dimethylguanidine;ethane?
The canonical SMILES for 1,2-dimethylguanidine;ethane is C/N=C(\N)NC.CC.
What is the InChIKey of 1,2-dimethylguanidine;ethane?
The InChIKey is UYBMXSXQGMUTNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N3.C2H6/c1-5-3(4)6-2;1-2/h1-2H3,(H3,4,5,6);1-2H3.
What are the key properties of 1,2-dimethylguanidine;ethane?
1,2-dimethylguanidine;ethane has a molecular weight of 117.20 g/mol, XLogP of 0.18, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylguanidine;ethane is sourced from PubChem (CID 54378223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).