About diethyl 2-diazobutanedioate
diethyl 2-diazobutanedioate (PubChem CID 54378761) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is diethyl 2-diazobutanedioate.
Molecular Properties
| Compound Name | diethyl 2-diazobutanedioate |
| PubChem CID | 54378761 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | diethyl 2-diazobutanedioate |
| SMILES | CCOC(=O)CC(=[N+]=[N-])C(=O)OCC |
| InChI | InChI=1S/C8H12N2O4/c1-3-13-7(11)5-6(10-9)8(12)14-4-2/h3-5H2,1-2H3 |
| InChIKey | UYKXQMZHKBUFJC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 89.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-diazobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-diazobutanedioate?
The IUPAC name of diethyl 2-diazobutanedioate (CID 54378761) is diethyl 2-diazobutanedioate.
What is the SMILES notation for diethyl 2-diazobutanedioate?
The canonical SMILES for diethyl 2-diazobutanedioate is CCOC(=O)CC(=[N+]=[N-])C(=O)OCC.
What is the InChIKey of diethyl 2-diazobutanedioate?
The InChIKey is UYKXQMZHKBUFJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4/c1-3-13-7(11)5-6(10-9)8(12)14-4-2/h3-5H2,1-2H3.
What are the key properties of diethyl 2-diazobutanedioate?
diethyl 2-diazobutanedioate has a molecular weight of 200.19 g/mol, XLogP of 0.17, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-diazobutanedioate is sourced from PubChem (CID 54378761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).