C22H32O3S — CID 54379038
3-[3,7-dimethyl-9-(4-methylphenyl)sulfonylnona-3,7-dienyl]-2,2-dimethyloxirane (PubChem CID 54379038) has the molecular formula C22H32O3S and a molecular weight of 376.56 g/mol. Its IUPAC name is 3-[3,7-dimethyl-9-(4-methylphenyl)sulfonylnona-3,7-dienyl]-2,2-dimethyloxirane.
| Compound Name | 3-[3,7-dimethyl-9-(4-methylphenyl)sulfonylnona-3,7-dienyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 54379038 |
| Molecular Formula | C22H32O3S |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 3-[3,7-dimethyl-9-(4-methylphenyl)sulfonylnona-3,7-dienyl]-2,2-dimethyloxirane |
| SMILES | CC(=CCS(=O)(=O)c1ccc(C)cc1)CCC=C(C)CCC1OC1(C)C |
| InChI | InChI=1S/C22H32O3S/c1-17(11-14-21-22(4,5)25-21)7-6-8-18(2)15-16-26(23,24)20-12-9-19(3)10-13-20/h7,9-10,12-13,15,21H,6,8,11,14,16H2,1-5H3 |
| InChIKey | UYQGBILRPATGMP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|